| Product Name | ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| CAS No. | 2199-47-5 |
| Synonyms | 3,5-Dimethyl-4-ethyl-1H-pyrrole-2-carboxylic acid ethyl ester |
| InChI | InChI=1/C11H17NO2/c1-5-9-7(3)10(12-8(9)4)11(13)14-6-2/h12H,5-6H2,1-4H3 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.2582 |
| Density | 1.041g/cm3 |
| Melting point | 87℃ |
| Boiling point | 306.7°C at 760 mmHg |
| Flash point | 139.3°C |
| Refractive index | 1.512 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2199-47-5 ethyl 4-ethyl-3,5-dimethyl-1h-pyrrole-2-carboxylate
service@apichina.com