| Product Name | ethyl 4-(butylamino)benzoate |
| CAS No. | 94-32-6 |
| Synonyms | Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
| InChI | InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.2955 |
| Density | 1.039g/cm3 |
| Melting point | 68-70℃ |
| Boiling point | 338.4°C at 760 mmHg |
| Flash point | 158.4°C |
| Refractive index | 1.534 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
94-32-6 ethyl 4-(butylamino)benzoate
service@apichina.com