| Product Name | Ethyl 4-bromo-3-ethoxybut-2-enoate |
| CAS No. | 1116-50-3 |
| Synonyms | 2-butenoic acid, 4-bromo-3-ethoxy-, ethyl ester; Ethyl 4-bromo-3-ethoxybut-2-enoate; ethyl (2Z)-4-bromo-3-ethoxybut-2-enoate |
| InChI | InChI=1/C8H13BrO3/c1-3-11-7(6-9)5-8(10)12-4-2/h5H,3-4,6H2,1-2H3/b7-5- |
| Molecular Formula | C8H13BrO3 |
| Molecular Weight | 237.091 |
| Density | 1.339g/cm3 |
| Boiling point | 265.2°C at 760 mmHg |
| Flash point | 114.2°C |
| Refractive index | 1.479 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1116-50-3 ethyl 4-bromo-3-ethoxybut-2-enoate
service@apichina.com