| Product Name | ethyl 4-aminobutyrate hydrochloride |
| CAS No. | 6937-16-2 |
| Synonyms | 4-aminobutyrate ethyl hydrochloride; 4-Aminobutyric acid ethyl ester hydrochloride; Ethyl4-aminobutyratehydrochloride,(4-Aminobutyricacidethylesterhydrochloride); 4-ethoxy-4-oxobutan-1-aminium chloride; ethyl 4-aminobutanoate |
| InChI | InChI=1/C6H13NO2/c1-2-9-6(8)4-3-5-7/h2-5,7H2,1H3 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.1729 |
| Density | 0.973g/cm3 |
| Melting point | 89-91℃ |
| Boiling point | 182.1°C at 760 mmHg |
| Flash point | 54.5°C |
| Refractive index | 1.434 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
6937-16-2 ethyl 4-aminobutyrate hydrochloride
service@apichina.com