| Product Name | ethyl 4-amino-3,5-diiodobenzoate |
| CAS No. | 5400-81-7 |
| InChI | InChI=1/C9H9I2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
| Molecular Formula | C9H9I2NO2 |
| Molecular Weight | 416.9822 |
| Density | 2.191g/cm3 |
| Melting point | 148℃ |
| Boiling point | 449.1°C at 760 mmHg |
| Flash point | 225.4°C |
| Refractive index | 1.689 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
service@apichina.com