| Product Name | Ethyl 4-amino-2-mercaptopyrimidine-5-carboxylate |
| CAS No. | 774-07-2 |
| Synonyms | 4-Amino-2-mercaptopyrimidine-5-carboxylic acid ethyl ester; ethyl 6-amino-2-thioxo-1,2-dihydropyrimidine-5-carboxylate |
| InChI | InChI=1/C7H9N3O2S/c1-2-12-6(11)4-3-9-7(13)10-5(4)8/h3H,2H2,1H3,(H3,8,9,10,13) |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.2303 |
| Density | 1.48g/cm3 |
| Melting point | 261℃ |
| Boiling point | 329.7°C at 760 mmHg |
| Flash point | 153.2°C |
| Refractive index | 1.659 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
774-07-2 ethyl 4-amino-2-mercaptopyrimidine-5-carboxylate
service@apichina.com