| Product Name | ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| CAS No. | 2386-26-7 |
| Synonyms | 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| InChI | InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.2417 |
| Density | 1.125g/cm3 |
| Melting point | 139℃ |
| Boiling point | 348.9°C at 760 mmHg |
| Flash point | 164.8°C |
| Refractive index | 1.517 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1h-pyrrole-2-carboxylate
service@apichina.com