| Product Name | ethyl 4,6-dichloro-3-formyl-1H-indole-2-carboxylate |
| CAS No. | 153435-96-2 |
| InChI | InChI=1/C12H9Cl2NO3/c1-2-18-12(17)11-7(5-16)10-8(14)3-6(13)4-9(10)15-11/h3-5,15H,2H2,1H3 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.1108 |
| Density | 1.491g/cm3 |
| Melting point | 214℃ |
| Boiling point | 485.1°C at 760 mmHg |
| Flash point | 247.2°C |
| Refractive index | 1.667 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
153435-96-2 ethyl 4,6-dichloro-3-formyl-1h-indole-2-carboxylate
service@apichina.com