| Product Name | ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
| CAS No. | 227958-96-5 |
| Synonyms | ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
| InChI | InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
| Molecular Formula | C13H11Cl2NO2S |
| Molecular Weight | 316.2029 |
| Density | 1.42g/cm3 |
| Melting point | 133℃ |
| Boiling point | 410.2°C at 760 mmHg |
| Flash point | 201.9°C |
| Refractive index | 1.643 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
227958-96-5 ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate
service@apichina.com