| Product Name | Ethyl 4,5-dimethoxy-2-nitrobenzoate |
| CAS No. | 100905-33-7 |
| Synonyms | 4,5-Dimethoxy-2-nitrobenzoic acid ethyl ester~Ethyl 3,4-dimethoxy-6-nitrobenzoate~Ethyl 6-nitroveratrate |
| InChI | InChI=1/C11H13NO6/c1-4-18-11(13)7-5-9(16-2)10(17-3)6-8(7)12(14)15/h5-6H,4H2,1-3H3 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.224 |
| Density | 1.253g/cm3 |
| Boiling point | 392.3°C at 760 mmHg |
| Flash point | 174.7°C |
| Refractive index | 1.526 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
100905-33-7 ethyl 4,5-dimethoxy-2-nitrobenzoate
service@apichina.com