| Product Name | ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate |
| CAS No. | 1513-60-6 |
| Synonyms | Ethyl-4,4,4-trifluoro-3-(trifluoromethyl)-crotonate; 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid ethyl ester; 1-ethynyl-3,5-difluorobenzene |
| InChI | InChI=1/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H |
| Molecular Formula | C8H4F2 |
| Molecular Weight | 138.1142 |
| Density | 1.17g/cm3 |
| Boiling point | 147.1°C at 760 mmHg |
| Flash point | 32°C |
| Refractive index | 1.492 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
service@apichina.com