| Product Name | ethyl 3-(tert-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carboxylate |
| CAS No. | 306936-98-1 |
| Synonyms | Ethyl 3-(t-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carboxylate; 2-(2-chloro-4-fluorophenyl)ethanethioamide |
| InChI | InChI=1/C8H7ClFNS/c9-7-4-6(10)2-1-5(7)3-8(11)12/h1-2,4H,3H2,(H2,11,12) |
| Molecular Formula | C8H7ClFNS |
| Molecular Weight | 203.6643 |
| Density | 1.384g/cm3 |
| Boiling point | 309.9°C at 760 mmHg |
| Flash point | 141.2°C |
| Refractive index | 1.617 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306936-98-1 ethyl 3-(tert-butyl)-1-(4-fluorobenzyl)-1h-pyrazole-5-carboxylate
service@apichina.com