| Product Name | Ethyl 3-nitrocinnamate |
| CAS No. | 5396-71-4 |
| Synonyms | 3-Nitrocinnamic acid ethyl ester; 2-{[2-chloro-5-(morpholin-4-ylsulfonyl)phenyl]amino}-2-oxoethyl pyrazine-2-carboxylate; ethyl (2E)-3-(3-nitrophenyl)prop-2-enoate |
| InChI | InChI=1/C11H11NO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8H,2H2,1H3/b7-6+ |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.2093 |
| Density | 1.237g/cm3 |
| Melting point | 73-75℃ |
| Boiling point | 346.7°C at 760 mmHg |
| Flash point | 154.5°C |
| Refractive index | 1.582 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5396-71-4 ethyl 3-nitrocinnamate
service@apichina.com