| Product Name | Ethyl 3-mercaptopropionate |
| CAS No. | 5466-06-8 |
| Synonyms | 3-Mercaptopropionic Acid Ethyl Ester; ethyl 3-sulfanylpropanoate |
| InChI | InChI=1/C5H10O2S/c1-2-7-5(6)3-4-8/h8H,2-4H2,1H3 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.1967 |
| Density | 1.043g/cm3 |
| Boiling point | 194.3°C at 760 mmHg |
| Flash point | 72.8°C |
| Refractive index | 1.454 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5466-06-8 ethyl 3-mercaptopropionate
service@apichina.com