| Product Name | Ethyl 3-isothiocyanatobutyrate |
| CAS No. | 206750-29-0 |
| Synonyms | 3-Isothiocyanatobutyric acid ethyl ester; ethyl 3-isothiocyanatobutanoate |
| InChI | InChI=1/C7H11NO2S/c1-3-10-7(9)4-6(2)8-5-11/h6H,3-4H2,1-2H3 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.2327 |
| Density | 1.07g/cm3 |
| Boiling point | 252.7°C at 760 mmHg |
| Flash point | 106.6°C |
| Refractive index | 1.497 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
206750-29-0 ethyl 3-isothiocyanatobutyrate
service@apichina.com