| Product Name | ethyl 3-hydroxy-4,6-dimethoxy-2-oxoindoline-3-carboxylate |
| CAS No. | 23659-85-0 |
| Synonyms | ethyl 3-hydroxy-4,6-dimethoxy-2-oxo-2,3-dihydro-1H-indole-3-carboxylate |
| InChI | InChI=1/C13H15NO6/c1-4-20-12(16)13(17)10-8(14-11(13)15)5-7(18-2)6-9(10)19-3/h5-6,17H,4H2,1-3H3,(H,14,15) |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.2613 |
| Density | 1.348g/cm3 |
| Melting point | 189℃ |
| Boiling point | 476.9°C at 760 mmHg |
| Flash point | 242.2°C |
| Refractive index | 1.562 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
23659-85-0 ethyl 3-hydroxy-4,6-dimethoxy-2-oxoindoline-3-carboxylate
service@apichina.com