| Product Name | Ethyl 3-ethoxy-2-butenoate |
| CAS No. | 998-91-4 |
| Synonyms | 3-Ethoxy-2-butenoic acid ethyl ester~Ethyl 3-ethoxycrotonate; ethyl 3-ethoxybut-2-enoate |
| InChI | InChI=1/C8H14O3/c1-4-10-7(3)6-8(9)11-5-2/h6H,4-5H2,1-3H3 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.195 |
| Density | 0.965g/cm3 |
| Melting point | 30℃ |
| Boiling point | 209.5°C at 760 mmHg |
| Flash point | 58.3°C |
| Refractive index | 1.432 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
998-91-4 ethyl 3-ethoxy-2-butenoate
service@apichina.com