| Product Name | Ethyl 3-di-n-propylaminopropionate |
| CAS No. | 42980-55-2 |
| InChI | InChI=1/C11H23NO2/c1-4-8-12(9-5-2)10-7-11(13)14-6-3/h4-10H2,1-3H3 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.3058 |
| Density | 0.911g/cm3 |
| Boiling point | 254.7°C at 760 mmHg |
| Flash point | 81.4°C |
| Refractive index | 1.442 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
42980-55-2 ethyl 3-di-n-propylaminopropionate
service@apichina.com