| Product Name | ethyl 3-amino-4-(methylamino)benzoate |
| CAS No. | 66315-23-9 |
| Synonyms | -ETHYL 3-AMINO-4-(METHYLAMINO)BENZOATE; 3-Amino-4-(methylamino)benzoic acid ethyl ester |
| InChI | InChI=1/C10H14N2O2/c1-3-14-10(13)7-4-5-9(12-2)8(11)6-7/h4-6,12H,3,11H2,1-2H3 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.2304 |
| Density | 1.173g/cm3 |
| Melting point | 81℃ |
| Boiling point | 357.396°C at 760 mmHg |
| Flash point | 169.948°C |
| Refractive index | 1.598 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
66315-23-9 ethyl 3-amino-4-(methylamino)benzoate
service@apichina.com