| Product Name | Ethyl 3,5-dinitrobenzoate |
| CAS No. | 618-71-3 |
| Synonyms | 3,5-Dinitrobenzoic acid ethyl ester |
| InChI | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.1696 |
| Density | 1.433g/cm3 |
| Melting point | 94-95℃ |
| Boiling point | 367.1°C at 760 mmHg |
| Flash point | 171.8°C |
| Refractive index | 1.58 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
618-71-3 ethyl 3,5-dinitrobenzoate
service@apichina.com