| Product Name | Ethyl 3,5-dichloro-4-hydroxybenzoate |
| CAS No. | 17302-82-8 |
| Synonyms | 3,5-Dichloro-4-hydroxybenzoic acid ethyl ester |
| InChI | InChI=1/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.064 |
| Density | 1.414g/cm3 |
| Melting point | 98-102℃ |
| Boiling point | 316.6°C at 760 mmHg |
| Flash point | 145.3°C |
| Refractive index | 1.567 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17302-82-8 ethyl 3,5-dichloro-4-hydroxybenzoate
service@apichina.com