| Product Name | Ethyl 3-(4-chloroanilino)crotonate |
| CAS No. | 41014-75-9 |
| Synonyms | Crotonic acid, 3-(p-chloroanilino)-, ethyl ester; 3-(p-Chloroanilino)crotonic acid ethyl ester; 3-12-00-01380 (Beilstein Handbook Reference); BRN 3293913; Ethyl 3-(p-chloroanilino)-crotonate; NSC 96990; 2-Butenoic acid, 3-((4-chlorophenyl)amino)-, ethyl ester (9CI); ethyl 3-[(4-chlorophenyl)amino]but-2-enoate; ethyl (2Z)-3-[(4-chlorophenyl)amino]but-2-enoate |
| InChI | InChI=1/C12H14ClNO2/c1-3-16-12(15)8-9(2)14-11-6-4-10(13)5-7-11/h4-8,14H,3H2,1-2H3/b9-8- |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.6981 |
| Density | 1.196g/cm3 |
| Boiling point | 336.5°C at 760 mmHg |
| Flash point | 157.3°C |
| Refractive index | 1.568 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
41014-75-9 ethyl 3-(4-chloroanilino)crotonate
service@apichina.com