| Product Name | Ethyl 3,4,5-trimethylpyrrole-2-carboxylate |
| CAS No. | 2199-46-4 |
| Synonyms | 3,4,5-Trimethylpyrrole-2-carboxylic acid ethyl ester; ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate |
| InChI | InChI=1/C10H15NO2/c1-5-13-10(12)9-7(3)6(2)8(4)11-9/h11H,5H2,1-4H3 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.2316 |
| Density | 1.059g/cm3 |
| Boiling point | 298.1°C at 760 mmHg |
| Flash point | 134.1°C |
| Refractive index | 1.515 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
2199-46-4 ethyl 3,4,5-trimethylpyrrole-2-carboxylate
service@apichina.com