| Product Name | ethyl 3-(2-thienyl)-1H-pyrazole-5-carboxylate |
| CAS No. | 121195-03-7 |
| Synonyms | Ethyl 3-(2-thienyl)pyrazole-5-carboxylate; ethyl 5-thiophen-2-yl-1H-pyrazole-3-carboxylate; Ethyl 3-(thiophen-2-yl)-1H-pyrazole-5-carboxylate; Ethyl 5-thien-2-yl-1H-pyrazole-3-carboxylate |
| InChI | InChI=1/C10H10N2O2S/c1-2-14-10(13)8-6-7(11-12-8)9-4-3-5-15-9/h3-6H,2H2,1H3,(H,11,12) |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.2636 |
| Density | 1.306g/cm3 |
| Melting point | 138℃ |
| Boiling point | 430°C at 760 mmHg |
| Flash point | 213.9°C |
| Refractive index | 1.599 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
121195-03-7 ethyl 3-(2-thienyl)-1h-pyrazole-5-carboxylate
service@apichina.com