| Product Name | ethyl 3-[(2-furylmethyl)amino]propanoate |
| CAS No. | 175203-83-5 |
| Synonyms | ethyl N-(furan-2-ylmethyl)-beta-alaninate |
| InChI | InChI=1/C10H15NO3/c1-2-13-10(12)5-6-11-8-9-4-3-7-14-9/h3-4,7,11H,2,5-6,8H2,1H3 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.231 |
| Density | 1.075g/cm3 |
| Boiling point | 280.5°C at 760 mmHg |
| Flash point | 123.4°C |
| Refractive index | 1.479 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175203-83-5 ethyl 3-[(2-furylmethyl)amino]propanoate
service@apichina.com