| Product Name | ethyl 3-(2-chloroanilino)-2-cyanoacrylate |
| CAS No. | 64317-75-5 |
| Synonyms | ethyl (2E)-3-[(2-chlorophenyl)amino]-2-cyanoprop-2-enoate |
| InChI | InChI=1/C12H11ClN2O2/c1-2-17-12(16)9(7-14)8-15-11-6-4-3-5-10(11)13/h3-6,8,15H,2H2,1H3/b9-8+ |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.6809 |
| Density | 1.294g/cm3 |
| Melting point | 165℃ |
| Boiling point | 366.6°C at 760 mmHg |
| Flash point | 175.5°C |
| Refractive index | 1.591 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
64317-75-5 ethyl 3-(2-chloroanilino)-2-cyanoacrylate
service@apichina.com