| Product Name | ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate |
| CAS No. | 175135-96-3 |
| Synonyms | ethyl (2E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoate |
| InChI | InChI=1/C13H15ClO4/c1-4-18-11(15)8-6-9-5-7-10(16-2)13(17-3)12(9)14/h5-8H,4H2,1-3H3/b8-6+ |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.7088 |
| Density | 1.193g/cm3 |
| Melting point | 68℃ |
| Boiling point | 382.4°C at 760 mmHg |
| Flash point | 151.5°C |
| Refractive index | 1.542 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175135-96-3 ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate
service@apichina.com