| Product Name | ethyl 2-nitropropionate |
| CAS No. | 2531-80-8 |
| Synonyms | 2-Nitropropionic acid ethyl ester; ethyl 2-nitropropanoate; ethyl (2R)-2-nitropropanoate |
| InChI | InChI=1/C5H9NO4/c1-3-10-5(7)4(2)6(8)9/h4H,3H2,1-2H3/t4-/m1/s1 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.1293 |
| Density | 1.152g/cm3 |
| Boiling point | 191.3°C at 760 mmHg |
| Flash point | 89.4°C |
| Refractive index | 1.429 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2531-80-8 ethyl 2-nitropropionate
service@apichina.com