| Product Name | ethyl 2-methylnicotinate |
| CAS No. | 1721-26-2 |
| Synonyms | Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
| InChI | InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.077g/cm3 |
| Boiling point | 234.7°C at 760 mmHg |
| Flash point | 86°C |
| Refractive index | 1.506 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1721-26-2 ethyl 2-methylnicotinate
service@apichina.com