| Product Name | ethyl 2-mercapto-1H-imidazole-4-carboxylate |
| CAS No. | 64038-64-8 |
| Synonyms | ethyl 2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylate |
| InChI | InChI=1/C6H8N2O2S/c1-2-10-5(9)4-3-7-6(11)8-4/h3H,2H2,1H3,(H2,7,8,11) |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.2049 |
| Density | 1.35g/cm3 |
| Melting point | 191℃ |
| Boiling point | 254.3°C at 760 mmHg |
| Flash point | 107.6°C |
| Refractive index | 1.605 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
64038-64-8 ethyl 2-mercapto-1h-imidazole-4-carboxylate
service@apichina.com