| Product Name | Ethyl 2-isothiocyanatopropionate |
| CAS No. | 39574-16-8 |
| Synonyms | 2-Isothiocyanatopropionic acid ethyl ester; ethyl N-(thioxomethylidene)alaninate; ethyl N-(thioxomethylidene)-L-alaninate; ethyl N-(thioxomethylidene)-D-alaninate |
| InChI | InChI=1/C6H9NO2S/c1-3-9-6(8)5(2)7-4-10/h5H,3H2,1-2H3/t5-/m1/s1 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.2062 |
| Density | 1.1g/cm3 |
| Boiling point | 218.2°C at 760 mmHg |
| Flash point | 85.7°C |
| Refractive index | 1.499 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
39574-16-8 ethyl 2-isothiocyanatopropionate
service@apichina.com