| Product Name | ethyl 2-isothiocyanatobenzoate |
| CAS No. | 99960-09-5 |
| Synonyms | 2-(Ethoxycarbonyl)phenyl isothiocyanate; 2-Isothiocyanatobenzoic acid ethyl ester |
| InChI | InChI=1/C10H9NO2S/c1-2-13-10(12)8-5-3-4-6-9(8)11-7-14/h3-6H,2H2,1H3 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.249 |
| Density | 1.14g/cm3 |
| Boiling point | 333°C at 760 mmHg |
| Flash point | 155.2°C |
| Refractive index | 1.558 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
99960-09-5 ethyl 2-isothiocyanatobenzoate
service@apichina.com