| Product Name | ethyl 2-isothiocyanato-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| CAS No. | 85716-87-6 |
| InChI | InChI=1/C12H13NO2S2/c1-2-15-12(14)10-8-5-3-4-6-9(8)17-11(10)13-7-16/h2-6H2,1H3 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.3671 |
| Density | 1.33g/cm3 |
| Melting point | 45℃ |
| Boiling point | 445°C at 760 mmHg |
| Flash point | 222.9°C |
| Refractive index | 1.652 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
85716-87-6 ethyl 2-isothiocyanato-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
service@apichina.com