| Product Name | Ethyl 2-isocyanato-4-methylvalerate |
| CAS No. | 64505-10-8 |
| Synonyms | Ethyl 2-isocyanato-4-methylpentanoate~2-Isocyanato-4-methylvaleric acid ethyl ester; ethyl N-(oxomethylidene)leucinate |
| InChI | InChI=1/C9H15NO3/c1-4-13-9(12)8(10-6-11)5-7(2)3/h7-8H,4-5H2,1-3H3 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.2203 |
| Density | 1.02g/cm3 |
| Boiling point | 223.6°C at 760 mmHg |
| Flash point | 76.6°C |
| Refractive index | 1.461 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
64505-10-8 ethyl 2-isocyanato-4-methylvalerate
service@apichina.com