| Product Name | Ethyl 2-isocyanato-3-phenylpropionate |
| CAS No. | 87543-80-4 |
| Synonyms | 2-Isocyanato-3-phenylpropionic acid ethyl ester; ethyl N-(oxomethylidene)phenylalaninate |
| InChI | InChI=1/C12H13NO3/c1-2-16-12(15)11(13-9-14)8-10-6-4-3-5-7-10/h3-7,11H,2,8H2,1H3 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.2365 |
| Density | 1.08g/cm3 |
| Boiling point | 308.9°C at 760 mmHg |
| Flash point | 130.3°C |
| Refractive index | 1.517 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
87543-80-4 ethyl 2-isocyanato-3-phenylpropionate
service@apichina.com