| Product Name | ethyl 2-chloro-3-cyano-6-methylisonicotinate |
| CAS No. | 40108-12-1 |
| Synonyms | Isonicotinic acid, 2-chloro-3-cyano-6-methyl-, ethyl ester; ethyl 2-chloro-3-cyano-6-methylpyridine-4-carboxylate |
| InChI | InChI=1/C10H9ClN2O2/c1-3-15-10(14)7-4-6(2)13-9(11)8(7)5-12/h4H,3H2,1-2H3 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.6437 |
| Density | 1.3g/cm3 |
| Melting point | 57℃ |
| Boiling point | 387.7°C at 760 mmHg |
| Flash point | 188.2°C |
| Refractive index | 1.542 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
40108-12-1 ethyl 2-chloro-3-cyano-6-methylisonicotinate
service@apichina.com