| Product Name | ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate |
| CAS No. | 72701-63-4 |
| Synonyms | ethyl 2-chloro-3-cyano-6-methyl-5-nitropyridine-4-carboxylate |
| InChI | InChI=1/C10H8ClN3O4/c1-3-18-10(15)7-6(4-12)9(11)13-5(2)8(7)14(16)17/h3H2,1-2H3 |
| Molecular Formula | C10H8ClN3O4 |
| Molecular Weight | 269.6412 |
| Density | 1.46g/cm3 |
| Melting point | 55℃ |
| Boiling point | 416.4°C at 760 mmHg |
| Flash point | 205.6°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
72701-63-4 ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
service@apichina.com