| Product Name | Ethyl 2-bromooctanoate |
| CAS No. | 5445-29-4 |
| Synonyms | Ethyl 2-bromocaprylate; 2-Bromooctanoic acid ethyl ester; Octanoic acid, 2-bromoethyl ester; α-Bromo-octanoic acid ethyl ester; Ethyl 2-bromooctanoate, 98+%; Ethyl 2-caprylate; ALPHA-BROMO-OCTANOIC ACID ETHYL ESTER; ethyl (2S)-2-bromooctanoate; ethyl (2R)-2-bromooctanoate |
| InChI | InChI=1/C10H19BrO2/c1-3-5-6-7-8-9(11)10(12)13-4-2/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 251.1607 |
| Density | 1.192g/cm3 |
| Boiling point | 243.1°C at 760 mmHg |
| Flash point | 112.1°C |
| Refractive index | 1.461 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5445-29-4 ethyl 2-bromooctanoate
service@apichina.com