| Product Name | ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate |
| CAS No. | 22900-83-0 |
| Synonyms | ethyl 2-bromo-4-methylthiazole-5-carboxylate |
| InChI | InChI=1/C7H8BrNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
| Molecular Formula | C7H8BrNO2S |
| Molecular Weight | 250.1129 |
| Density | 1.573g/cm3 |
| Melting point | 68℃ |
| Boiling point | 287.086°C at 760 mmHg |
| Flash point | 127.426°C |
| Refractive index | 1.563 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
service@apichina.com