| Product Name | ethyl 2-amino-4-propylpyrimidine-5-carboxylate |
| CAS No. | 127957-83-9 |
| InChI | InChI=1/C10H15N3O2/c1-3-5-8-7(9(14)15-4-2)6-12-10(11)13-8/h6H,3-5H2,1-2H3,(H2,11,12,13) |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.245 |
| Density | 1.15g/cm3 |
| Melting point | 127℃ |
| Boiling point | 396.9°C at 760 mmHg |
| Flash point | 193.8°C |
| Refractive index | 1.542 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
127957-83-9 ethyl 2-amino-4-propylpyrimidine-5-carboxylate
service@apichina.com