| Product Name | Ethyl 2-amino-4-methylthiophene-3-carboxylate |
| CAS No. | 43088-42-2 |
| Synonyms | 2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester |
| InChI | InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.2434 |
| Density | 1.219g/cm3 |
| Melting point | 72℃ |
| Boiling point | 279.1°C at 760 mmHg |
| Flash point | 122.6°C |
| Refractive index | 1.573 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
43088-42-2 ethyl 2-amino-4-methylthiophene-3-carboxylate
service@apichina.com