| Sales Email | Service@apichina.com |
| CAS No. | 81633-29-6 |
| Product Name | ethyl 2-amino-4-methylpyrimidine-5-carboxylate |
| InChI | InChI=1/C8H11N3O2/c1-3-13-7(12)6-4-10-8(9)11-5(6)2/h4H,3H2,1-2H3,(H2,9,10,11) |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.1918 |
| Density | 1.217g/cm3 |
| Melting point | 220℃ |
| Boiling point | 350.5°C at 760 mmHg |
| Flash point | 165.8°C |
| Refractive index | 1.556 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
