| Product Name | Ethyl 2-amino-3-(1H-indol-3-yl)propanoate |
| CAS No. | 7479-05-2 |
| Synonyms | L-Tryptophan, ethyl ester; L-Tryptophan ethyl ester; Ethyl L-tryptophanate; ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride |
| InChI | InChI=1/C13H16N2O2.ClH/c1-2-17-13(16)11(14)7-9-8-15-12-6-4-3-5-10(9)12;/h3-6,8,11,15H,2,7,14H2,1H3;1H/t11-;/m1./s1 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.7393 |
| Melting point | 218℃ |
| Boiling point | 427.8°C at 760 mmHg |
| Flash point | 212.5°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7479-05-2 ethyl 2-amino-3-(1h-indol-3-yl)propanoate
service@apichina.com