| Product Name | ethyl 2-(5-bromo-2-thienyl)-2-oxoacetate |
| CAS No. | 22098-10-8 |
| Synonyms | Ethyl (5-bromothien-2-yl)glyoxylate; ethyl (5-bromothiophen-2-yl)(oxo)acetate |
| InChI | InChI=1/C8H7BrO3S/c1-2-12-8(11)7(10)5-3-4-6(9)13-5/h3-4H,2H2,1H3 |
| Molecular Formula | C8H7BrO3S |
| Molecular Weight | 263.1084 |
| Density | 1.612g/cm3 |
| Melting point | 50℃ |
| Boiling point | 325°C at 760 mmHg |
| Flash point | 150.3°C |
| Refractive index | 1.568 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
22098-10-8 ethyl 2-(5-bromo-2-thienyl)-2-oxoacetate
service@apichina.com