| Product Name | ethyl 2,4-dichloro-6-methylnicotinate |
| CAS No. | 86129-63-7 |
| Synonyms | ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
| InChI | InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.0793 |
| Density | 1.32g/cm3 |
| Melting point | 56℃ |
| Boiling point | 298.2°C at 760 mmHg |
| Flash point | 134.1°C |
| Refractive index | 1.537 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
service@apichina.com