| Product Name | Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate |
| CAS No. | 112055-36-4 |
| Synonyms | Ethyl 1-(4-chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| InChI | InChI=1/C6H4FI/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Formula | C6H4FI |
| Molecular Weight | 221.9988 |
| Density | 1.918g/cm3 |
| Melting point | 52-54℃ |
| Boiling point | 183°C at 760 mmHg |
| Flash point | 67.2°C |
| Refractive index | 1.591 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
112055-36-4 ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate
service@apichina.com