| Product Name | ethyl 2-(4,5-dichloro-1H-imidazol-1-yl)acetate |
| CAS No. | 175137-67-4 |
| Synonyms | ethyl (4,5-dichloro-1H-imidazol-1-yl)acetate |
| InChI | InChI=1/C7H8Cl2N2O2/c1-2-13-5(12)3-11-4-10-6(8)7(11)9/h4H,2-3H2,1H3 |
| Molecular Formula | C7H8Cl2N2O2 |
| Molecular Weight | 223.0566 |
| Density | 1.45g/cm3 |
| Melting point | 64℃ |
| Boiling point | 365°C at 760 mmHg |
| Flash point | 174.5°C |
| Refractive index | 1.57 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175137-67-4 ethyl 2-(4,5-dichloro-1h-imidazol-1-yl)acetate
service@apichina.com