| Product Name | ethyl 2,3-dihydroxybenzoate |
| CAS No. | 3943-73-5 |
| Synonyms | 2,3-Dihydroxy-benzoic acid ethyl ester |
| InChI | InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.1733 |
| Density | 1.294g/cm3 |
| Melting point | 65℃ |
| Boiling point | 307.2°C at 760 mmHg |
| Flash point | 123°C |
| Refractive index | 1.573 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3943-73-5 ethyl 2,3-dihydroxybenzoate
service@apichina.com