| Product Name | Ethyl 2,3-dibromobutyrate |
| CAS No. | 609-11-0 |
| Synonyms | 2,3-Dibromobutyric acid ethyl ester; 2,3-Dibromo-n-butyric acid ethyl ester; ethyl 2,3-dibromobutanoate |
| InChI | InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
| Molecular Formula | C6H10Br2O2 |
| Molecular Weight | 273.9504 |
| Density | 1.731g/cm3 |
| Boiling point | 226.7°C at 760 mmHg |
| Flash point | 90.9°C |
| Refractive index | 1.506 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
609-11-0 ethyl 2,3-dibromobutyrate
service@apichina.com