| Product Name | ethyl 2-(3,5-dichloro-4-oxo-1,4-dihydropyridin-1-yl)acetate |
| CAS No. | 70149-51-8 |
| Synonyms | ethyl (3,5-dichloro-4-oxopyridin-1(4H)-yl)acetate |
| InChI | InChI=1/C9H9Cl2NO3/c1-2-15-8(13)5-12-3-6(10)9(14)7(11)4-12/h3-4H,2,5H2,1H3 |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.0787 |
| Density | 1.42g/cm3 |
| Melting point | 209℃ |
| Boiling point | 319.4°C at 760 mmHg |
| Flash point | 146.9°C |
| Refractive index | 1.558 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
70149-51-8 ethyl 2-(3,5-dichloro-4-oxo-1,4-dihydropyridin-1-yl)acetate
service@apichina.com